AryKeygan AryKeygan

24-09-2019
Social Studies

contestada

Place the dates in the correct chronological order from top to bottom.

100 CE

2000 CE

100 BCE

1000 BCE

Respuesta :

Derpynate Derpynate

24-09-2019

Answer:

2000 CE 1000BCE 100 1000

Answer Link

jakeyd86 jakeyd86

24-09-2019

100 BCE

1000 BCE

100 CE

2000 CE

Answer Link

Otras preguntas

Why is it necessary to create rules before a formal group discussion?O to ensure that speakers state only factsO to limit unpopular opinionsO to help speakers s

Solve the system of linear equations using linear combination 3a + 6b = 45 2a - 2b = -12 Which is the solution to the system?

Which of the following macromolecules are correctly matched with one of their functions? Nucleic acids—insulate; carbohydrates—catalyze chemical reactions Nu

How can △WXY be mapped to △MNQ? First, translate vertex w to vertex M. Next, reflect △WXY across the line containing 1) line segment WX 2) line segment WY 3) l

What was one of the goals of the Muslim league?

Historically, the greatest threats to human health came from…

Which sentence below does NOT contain an oxymoron? A.after the reunion,one of the children was found missing B.the toddler mixed all the paint together,resultin

Classify each of these reactions. Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g)Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g) acid–base neutralization precipitation redox none of the above 2NaCl(

The president can quickly direct the agencies of the executive branch to respond to economic. True or False

Which of these describes the Compromise of 1877?A. Slaveholding states agreed to let California become a free state,and free states agreed to the passage of the