bhbygggf4 bhbygggf4

22-09-2018
Mathematics

contestada

To close the blades of the scissors in this photo, you would have to close the handles. When you open the scissors, the angle formed by the blades will always be the same as the angle formed by the handle.

Which theorem could be used to verify this fact?

Respuesta :

lesliekolleroxrkcf lesliekolleroxrkcf

23-09-2018

vertical angles are congruent. your teacher and text may call them opposite angles instead... they are the same thing.

Answer Link

Otras preguntas

What concept is the reason for balancing recations

a child's toy consists of a piece of plastic attached to a spring. the spring is compressed against the floor a distance of 2.0 cm and released. if the spring

Suppose you want to design a medical centrifuge to subject samples to normal accelerations of 1000 g’s. (a) If the distance from the center of the centrifuge to

You are comparing two investment options that each pay 6% interest, compounded annually. Both options will provide you with $12,000 of income. Option A pays $2,

A flask contains a gas mixture of hydrogen and nitrogen. The total pressure of the mix is 2.0 atm. The partial pressure of the hydrogen is 0.8 atm. What is the

PbS(s)+4H2O2(aq)→PbSO4(s)+4H2O(l)PbS(s)+4H2O2(aq)→PbSO4(s)+4H2O(l) Express your answers as chemical symbols separated by a comma. Enter the oxidized element fir

What is the output of the following Python program? list1 = [2, 3, 4] list2 = [1, 5] list3 = [0] list3 = list2 + list1 print(list3) A. [0, 1, 5, 2, 3, 4] B. [1,

Exponential function?

What is the difference? x/x^2-16 - 3/x-4 2(x+6) (x+4)(x-4) -2(x+6) (x+4)(x-4) X-3 (x+5)(x-4) -2(x-6) (x+4)(x-4)

You swing a bucket full of water in a vertical circle at the end of a rope. The mass of the bucket plus the water is 2.4 kg. The center of mass of the bucket pl